C14H19F3O3 — CID 158179431
1,1,1-trifluoro-3-(8-prop-2-enyl-1,4-dioxaspiro[4.5]decan-8-yl)propan-2-one (PubChem CID 158179431) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(8-prop-2-enyl-1,4-dioxaspiro[4.5]decan-8-yl)propan-2-one.
| Compound Name | 1,1,1-trifluoro-3-(8-prop-2-enyl-1,4-dioxaspiro[4.5]decan-8-yl)propan-2-one |
|---|---|
| PubChem CID | 158179431 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1,1,1-trifluoro-3-(8-prop-2-enyl-1,4-dioxaspiro[4.5]decan-8-yl)propan-2-one |
| SMILES | C=CCC1(CC(=O)C(F)(F)F)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H19F3O3/c1-2-3-12(10-11(18)14(15,16)17)4-6-13(7-5-12)19-8-9-20-13/h2H,1,3-10H2 |
| InChIKey | JWNTXKKONQPUGB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|