C13H11N3O3S — CID 158179549
N-[4-[(4-cyano-2-pyridinyl)oxy]phenyl]methanesulfonamide (PubChem CID 158179549) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-[4-[(4-cyano-2-pyridinyl)oxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4-cyano-2-pyridinyl)oxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 158179549 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-[4-[(4-cyano-2-pyridinyl)oxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2cc(C#N)ccn2)cc1 |
| InChI | InChI=1S/C13H11N3O3S/c1-20(17,18)16-11-2-4-12(5-3-11)19-13-8-10(9-14)6-7-15-13/h2-8,16H,1H3 |
| InChIKey | FYKIFDHRTXDBBK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |