C31H42BClO7 — CID 158180102
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-chloro-3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate (PubChem CID 158180102) has the molecular formula C31H42BClO7 and a molecular weight of 572.94 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-chloro-3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-chloro-3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
|---|---|
| PubChem CID | 158180102 |
| Molecular Formula | C31H42BClO7 |
| Molecular Weight | 572.94 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[(7-chloro-3-ethyl-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)COc2ccc3c(c2Cl)B(O)OC3CC)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H42BClO7/c1-7-21-19-9-10-22(26(33)25(19)32(37)40-21)38-16-24(35)39-23-15-29(5,8-2)28(36)18(4)31-13-11-17(3)30(23,6)27(31)20(34)12-14-31/h8-10,17-18,21,23,27-28,36-37H,2,7,11-16H2,1,3-6H3/t17-,18+,21?,23-,27+,28+,29-,30+,31+/m1/s1 |
| InChIKey | WWOQAFXWXVAYHY-LMYWAJKPSA-N |
| XLogP | 4.79 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|