C14H19NO — CID 15818088
(3aS,4S,6aR)-2-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol (PubChem CID 15818088) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol.
| Compound Name | (3aS,4S,6aR)-2-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 15818088 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3aS,4S,6aR)-2-methyl-4-phenyl-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-4-ol |
| SMILES | CN1C[C@@H]2CC[C@@](O)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C14H19NO/c1-15-9-11-7-8-14(16,13(11)10-15)12-5-3-2-4-6-12/h2-6,11,13,16H,7-10H2,1H3/t11-,13+,14+/m0/s1 |
| InChIKey | MTDZUFHPKHTIGY-IACUBPJLSA-N |
| XLogP | 1.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |