C14H26O3 — CID 158180894
(3R,4S,6S)-2-(but-3-enoxymethyl)-6-methoxy-3,4,5-trimethyloxane (PubChem CID 158180894) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (3R,4S,6S)-2-(but-3-enoxymethyl)-6-methoxy-3,4,5-trimethyloxane.
| Compound Name | (3R,4S,6S)-2-(but-3-enoxymethyl)-6-methoxy-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 158180894 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (3R,4S,6S)-2-(but-3-enoxymethyl)-6-methoxy-3,4,5-trimethyloxane |
| SMILES | C=CCCOCC1O[C@H](OC)C(C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C14H26O3/c1-6-7-8-16-9-13-11(3)10(2)12(4)14(15-5)17-13/h6,10-14H,1,7-9H2,2-5H3/t10-,11+,12?,13?,14-/m0/s1 |
| InChIKey | VCGYBZYYDNUNLL-OESUJAFSSA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|