C14H18FN — CID 15818091
(3aS,4S,6aR)-4-(4-fluorophenyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 15818091) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(4-fluorophenyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,4S,6aR)-4-(4-fluorophenyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 15818091 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (3aS,4S,6aR)-4-(4-fluorophenyl)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CN1C[C@@H]2CC[C@H](c3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C14H18FN/c1-16-8-11-4-7-13(14(11)9-16)10-2-5-12(15)6-3-10/h2-3,5-6,11,13-14H,4,7-9H2,1H3/t11-,13+,14+/m0/s1 |
| InChIKey | ONLZJKUPPKKNIQ-IACUBPJLSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |