C15H18F3N — CID 15818092
(3aS,4S,6aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 15818092) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,4S,6aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 15818092 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (3aS,4S,6aR)-2-methyl-4-[3-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CN1C[C@@H]2CC[C@H](c3cccc(C(F)(F)F)c3)[C@@H]2C1 |
| InChI | InChI=1S/C15H18F3N/c1-19-8-11-5-6-13(14(11)9-19)10-3-2-4-12(7-10)15(16,17)18/h2-4,7,11,13-14H,5-6,8-9H2,1H3/t11-,13+,14+/m0/s1 |
| InChIKey | CFYFSIVXKZDLEE-IACUBPJLSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |