About bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium
bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium (PubChem CID 158181823) has the molecular formula C8H16F6N2O4S2
and a molecular weight of 382.35 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium |
| PubChem CID | 158181823 |
| Molecular Formula | C8H16F6N2O4S2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium |
| SMILES | CC(C)(C)CC[NH3+].O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C2F6NO4S2/c1-6(2,3)4-5-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-5,7H2,1-3H3;/q;-1/p+1 |
| InChIKey | FYRLFXZRIKYVBS-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium (CID 158181823) is bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium is CC(C)(C)CC[NH3+].O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium?
The InChIKey is FYRLFXZRIKYVBS-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N.C2F6NO4S2/c1-6(2,3)4-5-7;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-5,7H2,1-3H3;/q;-1/p+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium?
bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium has a molecular weight of 382.35 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutylazanium is sourced from PubChem (CID 158181823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).