C21H30O3 — CID 15818198
[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] hydrogen carbonate (PubChem CID 15818198) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] hydrogen carbonate.
| Compound Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 15818198 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] hydrogen carbonate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/COC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C21H30O3/c1-16(8-6-9-17(2)13-15-24-20(22)23)11-12-19-18(3)10-7-14-21(19,4)5/h6,8-9,11-13H,7,10,14-15H2,1-5H3,(H,22,23)/b9-6+,12-11+,16-8+,17-13+ |
| InChIKey | SNNNNJSLHCXUOJ-OVSJKPMPSA-N |
| XLogP | 6.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|