C20H32O5 — CID 15818202
(1R,2R,3aR,8aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-1-(hydroxymethyl)-2,3a-dimethyl-2,3,4,7,8,8a-hexahydroazulene-5-carboxylic acid (PubChem CID 15818202) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1R,2R,3aR,8aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-1-(hydroxymethyl)-2,3a-dimethyl-2,3,4,7,8,8a-hexahydroazulene-5-carboxylic acid.
| Compound Name | (1R,2R,3aR,8aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-1-(hydroxymethyl)-2,3a-dimethyl-2,3,4,7,8,8a-hexahydroazulene-5-carboxylic acid |
|---|---|
| PubChem CID | 15818202 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1R,2R,3aR,8aS)-1-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-1-(hydroxymethyl)-2,3a-dimethyl-2,3,4,7,8,8a-hexahydroazulene-5-carboxylic acid |
| SMILES | C[C@@H]1C[C@]2(C)CC(C(=O)O)=CCC[C@@H]2[C@@]1(CO)CC/C(=C/CO)CO |
| InChI | InChI=1S/C20H32O5/c1-14-10-19(2)11-16(18(24)25)4-3-5-17(19)20(14,13-23)8-6-15(12-22)7-9-21/h4,7,14,17,21-23H,3,5-6,8-13H2,1-2H3,(H,24,25)/b15-7-/t14-,17+,19-,20-/m1/s1 |
| InChIKey | JCWINCIZDNXUMA-SPQHETMKSA-N |
| XLogP | 2.51 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|