C20H30O4 — CID 15818204
(6aR,7S,8R,10aS)-7-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one (PubChem CID 15818204) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (6aR,7S,8R,10aS)-7-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one.
| Compound Name | (6aR,7S,8R,10aS)-7-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one |
|---|---|
| PubChem CID | 15818204 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (6aR,7S,8R,10aS)-7-[(Z)-5-hydroxy-3-(hydroxymethyl)pent-3-enyl]-7,8-dimethyl-5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-3-one |
| SMILES | C[C@@H]1CC[C@@]23COC(=O)C2=CCC[C@@H]3[C@@]1(C)CC/C(=C/CO)CO |
| InChI | InChI=1S/C20H30O4/c1-14-6-10-20-13-24-18(23)16(20)4-3-5-17(20)19(14,2)9-7-15(12-22)8-11-21/h4,8,14,17,21-22H,3,5-7,9-13H2,1-2H3/b15-8-/t14-,17-,19+,20-/m1/s1 |
| InChIKey | BYASTQVSNAVAKL-VRKDWOBOSA-N |
| XLogP | 2.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|