C22H28N2O9 — CID 158182081
3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid;3-formyl-2,2-dimethylcyclopropane-1-carboxylic acid;methyl 2-cyanoacetate (PubChem CID 158182081) has the molecular formula C22H28N2O9 and a molecular weight of 464.47 g/mol. Its IUPAC name is 3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid;3-formyl-2,2-dimethylcyclopropane-1-carboxylic acid;methyl 2-cyanoacetate.
| Compound Name | 3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid;3-formyl-2,2-dimethylcyclopropane-1-carboxylic acid;methyl 2-cyanoacetate |
|---|---|
| PubChem CID | 158182081 |
| Molecular Formula | C22H28N2O9 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylic acid;3-formyl-2,2-dimethylcyclopropane-1-carboxylic acid;methyl 2-cyanoacetate |
| SMILES | CC1(C)C(C=O)C1C(=O)O.COC(=O)/C(C#N)=C/C1C(C(=O)O)C1(C)C.COC(=O)CC#N |
| InChI | InChI=1S/C11H13NO4.C7H10O3.C4H5NO2/c1-11(2)7(8(11)9(13)14)4-6(5-12)10(15)16-3;1-7(2)4(3-8)5(7)6(9)10;1-7-4(6)2-3-5/h4,7-8H,1-3H3,(H,13,14);3-5H,1-2H3,(H,9,10);2H2,1H3/b6-4+;; |
| InChIKey | FYSGZWRXNVMBSS-SLNOCBGISA-N |
| XLogP | 1.58 |
| TPSA | 191.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|