C14H22O7 — CID 158182457
dimethyl 2,3-dimethylbutanedioate;3,4-dimethyloxolane-2,5-dione (PubChem CID 158182457) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is dimethyl 2,3-dimethylbutanedioate;3,4-dimethyloxolane-2,5-dione.
| Compound Name | dimethyl 2,3-dimethylbutanedioate;3,4-dimethyloxolane-2,5-dione |
|---|---|
| PubChem CID | 158182457 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | dimethyl 2,3-dimethylbutanedioate;3,4-dimethyloxolane-2,5-dione |
| SMILES | CC1C(=O)OC(=O)C1C.COC(=O)C(C)C(C)C(=O)OC |
| InChI | InChI=1S/C8H14O4.C6H8O3/c1-5(7(9)11-3)6(2)8(10)12-4;1-3-4(2)6(8)9-5(3)7/h5-6H,1-4H3;3-4H,1-2H3 |
| InChIKey | FYTKPDBTRSGLMP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|