C23H36O5 — CID 15818343
methyl (1R,2R,4aR,4bS,8aS,10R,10aR)-10-acetyloxy-1-formyl-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-2-carboxylate (PubChem CID 15818343) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is methyl (1R,2R,4aR,4bS,8aS,10R,10aR)-10-acetyloxy-1-formyl-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-2-carboxylate.
| Compound Name | methyl (1R,2R,4aR,4bS,8aS,10R,10aR)-10-acetyloxy-1-formyl-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 15818343 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | methyl (1R,2R,4aR,4bS,8aS,10R,10aR)-10-acetyloxy-1-formyl-4b,8,8,10a-tetramethyl-2,3,4,4a,5,6,7,8a,9,10-decahydro-1H-phenanthrene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3C[C@@H](OC(C)=O)[C@@]2(C)[C@@H]1C=O |
| InChI | InChI=1S/C23H36O5/c1-14(25)28-19-12-18-21(2,3)10-7-11-22(18,4)17-9-8-15(20(26)27-6)16(13-24)23(17,19)5/h13,15-19H,7-12H2,1-6H3/t15-,16-,17-,18+,19-,22-,23+/m1/s1 |
| InChIKey | QKPLRAHXBZXDEV-CMHDHDCYSA-N |
| XLogP | 4.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|