C11H10O2 — CID 158184772
5-buta-1,3-dien-2-yl-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 158184772) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-buta-1,3-dien-2-yl-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 5-buta-1,3-dien-2-yl-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 158184772 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 5-buta-1,3-dien-2-yl-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | C=CC(=C)c1ccc(O)c(=O)cc1 |
| InChI | InChI=1S/C11H10O2/c1-3-8(2)9-4-6-10(12)11(13)7-5-9/h3-7H,1-2H2,(H,12,13) |
| InChIKey | UDCVEXMTIKBYKB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|