C17H18O2 — CID 15818525
(1S,12S,13S)-12-hydroxy-13-methyltetracyclo[11.2.1.01,10.02,7]hexadeca-2,4,6,9-tetraen-8-one (PubChem CID 15818525) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S,12S,13S)-12-hydroxy-13-methyltetracyclo[11.2.1.01,10.02,7]hexadeca-2,4,6,9-tetraen-8-one.
| Compound Name | (1S,12S,13S)-12-hydroxy-13-methyltetracyclo[11.2.1.01,10.02,7]hexadeca-2,4,6,9-tetraen-8-one |
|---|---|
| PubChem CID | 15818525 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1S,12S,13S)-12-hydroxy-13-methyltetracyclo[11.2.1.01,10.02,7]hexadeca-2,4,6,9-tetraen-8-one |
| SMILES | C[C@]12CC[C@]3(C1)C(=CC(=O)c1ccccc13)C[C@@H]2O |
| InChI | InChI=1S/C17H18O2/c1-16-6-7-17(10-16)11(9-15(16)19)8-14(18)12-4-2-3-5-13(12)17/h2-5,8,15,19H,6-7,9-10H2,1H3/t15-,16-,17-/m0/s1 |
| InChIKey | YHXXRUKKXLZIEV-ULQDDVLXSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |