C32H44F3N7O3 — CID 158185421
4-[[[4-butoxy-3-(trifluoromethyl)phenyl]carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane (PubChem CID 158185421) has the molecular formula C32H44F3N7O3 and a molecular weight of 631.74 g/mol. Its IUPAC name is 4-[[[4-butoxy-3-(trifluoromethyl)phenyl]carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane.
| Compound Name | 4-[[[4-butoxy-3-(trifluoromethyl)phenyl]carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane |
|---|---|
| PubChem CID | 158185421 |
| Molecular Formula | C32H44F3N7O3 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | 4-[[[4-butoxy-3-(trifluoromethyl)phenyl]carbamoyl-(4-tert-butylcyclohexyl)amino]methyl]-N-(2H-tetrazol-5-yl)benzamide;methane |
| SMILES | C.CCCCOc1ccc(NC(=O)N(Cc2ccc(C(=O)Nc3nn[nH]n3)cc2)C2CCC(C(C)(C)C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C31H40F3N7O3.CH4/c1-5-6-17-44-26-16-13-23(18-25(26)31(32,33)34)35-29(43)41(24-14-11-22(12-15-24)30(2,3)4)19-20-7-9-21(10-8-20)27(42)36-28-37-39-40-38-28;/h7-10,13,16,18,22,24H,5-6,11-12,14-15,17,19H2,1-4H3,(H,35,43)(H2,36,37,38,39,40,42);1H4 |
| InChIKey | FZBVWHQRSKCZKW-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|