About 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane
4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane (PubChem CID 158185704) has the molecular formula C25H25Br3O
and a molecular weight of 581.19 g/mol. Its IUPAC name is 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane.
Molecular Properties
| Compound Name | 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane |
| PubChem CID | 158185704 |
| Molecular Formula | C25H25Br3O |
| Molecular Weight | 581.19 g/mol |
| Exact Mass | 577.95 |
| IUPAC Name | 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane |
| SMILES | Brc1ccc(Br)c2ccccc12.CC.CC.O=Cc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C11H7BrO.C10H6Br2.2C2H6/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11;11-9-5-6-10(12)8-4-2-1-3-7(8)9;2*1-2/h1-7H;1-6H;2*1-2H3 |
| InChIKey | FZCNGQRBQGOVHG-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.19 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane?
The IUPAC name of 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane (CID 158185704) is 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane.
What is the SMILES notation for 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane?
The canonical SMILES for 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane is Brc1ccc(Br)c2ccccc12.CC.CC.O=Cc1ccc(Br)c2ccccc12.
What is the InChIKey of 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane?
The InChIKey is FZCNGQRBQGOVHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrO.C10H6Br2.2C2H6/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11;11-9-5-6-10(12)8-4-2-1-3-7(8)9;2*1-2/h1-7H;1-6H;2*1-2H3.
What are the key properties of 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane?
4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane has a molecular weight of 581.19 g/mol, XLogP of 9.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromonaphthalene-1-carbaldehyde;1,4-dibromonaphthalene;ethane is sourced from PubChem (CID 158185704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).