About 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride
5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride (PubChem CID 158185762) has the molecular formula C14H24Cl4O4S
and a molecular weight of 430.22 g/mol. Its IUPAC name is 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride.
Molecular Properties
| Compound Name | 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride |
| PubChem CID | 158185762 |
| Molecular Formula | C14H24Cl4O4S |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride |
| SMILES | CC(C)(CCCCl)C(=O)Cl.CC1(C)CCCOC1=O.O=S(Cl)Cl |
| InChI | InChI=1S/C7H12Cl2O.C7H12O2.Cl2OS/c1-7(2,6(9)10)4-3-5-8;1-7(2)4-3-5-9-6(7)8;1-4(2)3/h3-5H2,1-2H3;3-5H2,1-2H3; |
| InChIKey | FZCRKKQLDYFZSB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride?
The IUPAC name of 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride (CID 158185762) is 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride.
What is the SMILES notation for 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride?
The canonical SMILES for 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride is CC(C)(CCCCl)C(=O)Cl.CC1(C)CCCOC1=O.O=S(Cl)Cl.
What is the InChIKey of 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride?
The InChIKey is FZCRKKQLDYFZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Cl2O.C7H12O2.Cl2OS/c1-7(2,6(9)10)4-3-5-8;1-7(2)4-3-5-9-6(7)8;1-4(2)3/h3-5H2,1-2H3;3-5H2,1-2H3;.
What are the key properties of 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride?
5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride has a molecular weight of 430.22 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,2-dimethylpentanoyl chloride;3,3-dimethyloxan-2-one;thionyl dichloride is sourced from PubChem (CID 158185762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).