C25H22ClF2NO — CID 158185840
2-(4-chloro-3-fluorophenyl)-1-[6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone (PubChem CID 158185840) has the molecular formula C25H22ClF2NO and a molecular weight of 425.91 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-1-[6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-1-[6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone |
|---|---|
| PubChem CID | 158185840 |
| Molecular Formula | C25H22ClF2NO |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-1-[6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(F)c1)C1CC12CCC(c1ccnc3ccc(F)cc13)CC2 |
| InChI | InChI=1S/C25H22ClF2NO/c26-21-3-1-15(11-22(21)28)12-24(30)20-14-25(20)8-5-16(6-9-25)18-7-10-29-23-4-2-17(27)13-19(18)23/h1-4,7,10-11,13,16,20H,5-6,8-9,12,14H2 |
| InChIKey | FZCWWDUGMWEMMI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |