C36H85N5 — CID 158186733
ethane;1-propan-2-ylpiperazine;bis(1-propan-2-ylpyrrolidine);3-propan-2-ylpyrrolidine (PubChem CID 158186733) has the molecular formula C36H85N5 and a molecular weight of 588.11 g/mol. Its IUPAC name is ethane;1-propan-2-ylpiperazine;bis(1-propan-2-ylpyrrolidine);3-propan-2-ylpyrrolidine.
| Compound Name | ethane;1-propan-2-ylpiperazine;bis(1-propan-2-ylpyrrolidine);3-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 158186733 |
| Molecular Formula | C36H85N5 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.68 |
| IUPAC Name | ethane;1-propan-2-ylpiperazine;bis(1-propan-2-ylpyrrolidine);3-propan-2-ylpyrrolidine |
| SMILES | CC.CC.CC.CC.CC(C)C1CCNC1.CC(C)N1CCCC1.CC(C)N1CCCC1.CC(C)N1CCNCC1 |
| InChI | InChI=1S/C7H16N2.3C7H15N.4C2H6/c1-7(2)9-5-3-8-4-6-9;1-6(2)7-3-4-8-5-7;2*1-7(2)8-5-3-4-6-8;4*1-2/h7-8H,3-6H2,1-2H3;6-8H,3-5H2,1-2H3;2*7H,3-6H2,1-2H3;4*1-2H3 |
| InChIKey | FZFPCZJNUJTIKW-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |