About tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine
tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine (PubChem CID 158188181) has the molecular formula C28H55N5O2
and a molecular weight of 493.78 g/mol. Its IUPAC name is tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine.
Molecular Properties
| Compound Name | tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine |
| PubChem CID | 158188181 |
| Molecular Formula | C28H55N5O2 |
| Molecular Weight | 493.78 g/mol |
| Exact Mass | 493.44 |
| IUPAC Name | tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine |
| SMILES | CCN1CCC(N2CCCCC2)CC1.CCN1CCC(N2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C16H31N3O2.C12H24N2/c1-5-17-8-6-14(7-9-17)18-10-12-19(13-11-18)15(20)21-16(2,3)4;1-2-13-10-6-12(7-11-13)14-8-4-3-5-9-14/h14H,5-13H2,1-4H3;12H,2-11H2,1H3 |
| InChIKey | FZKDDMKAAXPXGP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.78 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine?
The IUPAC name of tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine (CID 158188181) is tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine.
What is the SMILES notation for tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine?
The canonical SMILES for tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine is CCN1CCC(N2CCCCC2)CC1.CCN1CCC(N2CCN(C(=O)OC(C)(C)C)CC2)CC1.
What is the InChIKey of tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine?
The InChIKey is FZKDDMKAAXPXGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O2.C12H24N2/c1-5-17-8-6-14(7-9-17)18-10-12-19(13-11-18)15(20)21-16(2,3)4;1-2-13-10-6-12(7-11-13)14-8-4-3-5-9-14/h14H,5-13H2,1-4H3;12H,2-11H2,1H3.
What are the key properties of tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine?
tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine has a molecular weight of 493.78 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(1-ethylpiperidin-4-yl)piperazine-1-carboxylate;1-ethyl-4-piperidin-1-ylpiperidine is sourced from PubChem (CID 158188181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).