C21H38O11 — CID 158188742
(2R,4R,5R)-2-[[(3R,4R,6R)-6-tert-butyl-3,4-dihydroxy-5-methyloxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 158188742) has the molecular formula C21H38O11 and a molecular weight of 466.52 g/mol. Its IUPAC name is (2R,4R,5R)-2-[[(3R,4R,6R)-6-tert-butyl-3,4-dihydroxy-5-methyloxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4R,5R)-2-[[(3R,4R,6R)-6-tert-butyl-3,4-dihydroxy-5-methyloxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 158188742 |
| Molecular Formula | C21H38O11 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (2R,4R,5R)-2-[[(3R,4R,6R)-6-tert-butyl-3,4-dihydroxy-5-methyloxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC1[C@@H](O)[C@@H](O)C(CO[C@]2(C(=O)O)C[C@@H](O)[C@@H](C)C([C@H](O)[C@H](O)CO)O2)O[C@H]1C(C)(C)C |
| InChI | InChI=1S/C21H38O11/c1-9-11(23)6-21(19(28)29,32-17(9)15(26)12(24)7-22)30-8-13-16(27)14(25)10(2)18(31-13)20(3,4)5/h9-18,22-27H,6-8H2,1-5H3,(H,28,29)/t9-,10?,11-,12-,13?,14-,15-,16+,17?,18-,21-/m1/s1 |
| InChIKey | FZMACVOZNDFBDR-ODNMSHQWSA-N |
| XLogP | -1.54 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |