C10H17N2O9+ — CID 158189516
2-azaniumylethylazanium;3,4,5-tricarboxyoxolane-2-carboxylate (PubChem CID 158189516) has the molecular formula C10H17N2O9+ and a molecular weight of 309.25 g/mol. Its IUPAC name is 2-azaniumylethylazanium;3,4,5-tricarboxyoxolane-2-carboxylate.
| Compound Name | 2-azaniumylethylazanium;3,4,5-tricarboxyoxolane-2-carboxylate |
|---|---|
| PubChem CID | 158189516 |
| Molecular Formula | C10H17N2O9+ |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-azaniumylethylazanium;3,4,5-tricarboxyoxolane-2-carboxylate |
| SMILES | O=C([O-])C1OC(C(=O)O)C(C(=O)O)C1C(=O)O.[NH3+]CC[NH3+] |
| InChI | InChI=1S/C8H8O9.C2H8N2/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14;3-1-2-4/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16);1-4H2/p+1 |
| InChIKey | FZOLVKMERGROMI-UHFFFAOYSA-O |
| XLogP | -5.54 |
| TPSA | 216.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | -5.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |