C26H30F3N3O4 — CID 15819011
(1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide (PubChem CID 15819011) has the molecular formula C26H30F3N3O4 and a molecular weight of 505.54 g/mol. Its IUPAC name is (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide.
| Compound Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 15819011 |
| Molecular Formula | C26H30F3N3O4 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
| SMILES | C[C@]12C=CC(=O)N[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](C(=O)Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC[C@@H]12 |
| InChI | InChI=1S/C26H30F3N3O4/c1-24-11-9-17-15(4-8-21-25(17,2)12-10-22(33)31-21)16(24)5-6-18(24)23(34)30-14-3-7-20(32(35)36)19(13-14)26(27,28)29/h3,7,10,12-13,15-18,21H,4-6,8-9,11H2,1-2H3,(H,30,34)(H,31,33)/t15-,16-,17-,18+,21+,24-,25+/m0/s1 |
| InChIKey | AAKFAAQLGJUQMM-HEVGNLSTSA-N |
| XLogP | 5.47 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|