C32H32F2N4O5 — CID 158190340
1-[1-[2-[6-[[7-[3-(dimethylamino)propoxy]-6-methoxy-1,5-naphthyridin-4-yl]oxy]-5-fluoro-3-pyridinyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone (PubChem CID 158190340) has the molecular formula C32H32F2N4O5 and a molecular weight of 590.63 g/mol. Its IUPAC name is 1-[1-[2-[6-[[7-[3-(dimethylamino)propoxy]-6-methoxy-1,5-naphthyridin-4-yl]oxy]-5-fluoro-3-pyridinyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[1-[2-[6-[[7-[3-(dimethylamino)propoxy]-6-methoxy-1,5-naphthyridin-4-yl]oxy]-5-fluoro-3-pyridinyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 158190340 |
| Molecular Formula | C32H32F2N4O5 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 1-[1-[2-[6-[[7-[3-(dimethylamino)propoxy]-6-methoxy-1,5-naphthyridin-4-yl]oxy]-5-fluoro-3-pyridinyl]acetyl]cyclopropyl]-2-(4-fluorophenyl)ethanone |
| SMILES | COc1nc2c(Oc3ncc(CC(=O)C4(C(=O)Cc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCCN(C)C |
| InChI | InChI=1S/C32H32F2N4O5/c1-38(2)13-4-14-42-26-18-24-29(37-31(26)41-3)25(9-12-35-24)43-30-23(34)15-21(19-36-30)17-28(40)32(10-11-32)27(39)16-20-5-7-22(33)8-6-20/h5-9,12,15,18-19H,4,10-11,13-14,16-17H2,1-3H3 |
| InChIKey | FZRFCSPOVYCEIM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 103.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|