About (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate
(2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate (PubChem CID 158190866) has the molecular formula C22H21NO8
and a molecular weight of 427.41 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate |
| PubChem CID | 158190866 |
| Molecular Formula | C22H21NO8 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate |
| SMILES | CCOc1cccc(C2OCc3cc(COC(=O)ON4C(=O)CCC4=O)ccc3O2)c1 |
| InChI | InChI=1S/C22H21NO8/c1-2-27-17-5-3-4-15(11-17)21-28-13-16-10-14(6-7-18(16)30-21)12-29-22(26)31-23-19(24)8-9-20(23)25/h3-7,10-11,21H,2,8-9,12-13H2,1H3 |
| InChIKey | FZSSGOBFCVAESZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate (CID 158190866) is (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate is CCOc1cccc(C2OCc3cc(COC(=O)ON4C(=O)CCC4=O)ccc3O2)c1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate?
The InChIKey is FZSSGOBFCVAESZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO8/c1-2-27-17-5-3-4-15(11-17)21-28-13-16-10-14(6-7-18(16)30-21)12-29-22(26)31-23-19(24)8-9-20(23)25/h3-7,10-11,21H,2,8-9,12-13H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate?
(2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate has a molecular weight of 427.41 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) [2-(3-ethoxyphenyl)-4H-1,3-benzodioxin-6-yl]methyl carbonate is sourced from PubChem (CID 158190866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).