C33H24Cl2F6N6O2 — CID 158191840
4-(5-chloro-1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;5-chloro-2-[1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-1,3-benzoxazole (PubChem CID 158191840) has the molecular formula C33H24Cl2F6N6O2 and a molecular weight of 721.49 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;5-chloro-2-[1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-1,3-benzoxazole.
| Compound Name | 4-(5-chloro-1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;5-chloro-2-[1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 158191840 |
| Molecular Formula | C33H24Cl2F6N6O2 |
| Molecular Weight | 721.49 g/mol |
| Exact Mass | 720.12 |
| IUPAC Name | 4-(5-chloro-1,3-benzoxazol-2-yl)-1-N-(3,3,3-trifluoropropyl)benzene-1,2-diamine;5-chloro-2-[1-(3,3,3-trifluoropropyl)benzimidazol-5-yl]-1,3-benzoxazole |
| SMILES | FC(F)(F)CCn1cnc2cc(-c3nc4cc(Cl)ccc4o3)ccc21.Nc1cc(-c2nc3cc(Cl)ccc3o2)ccc1NCCC(F)(F)F |
| InChI | InChI=1S/C17H11ClF3N3O.C16H13ClF3N3O/c18-11-2-4-15-13(8-11)23-16(25-15)10-1-3-14-12(7-10)22-9-24(14)6-5-17(19,20)21;17-10-2-4-14-13(8-10)23-15(24-14)9-1-3-12(11(21)7-9)22-6-5-16(18,19)20/h1-4,7-9H,5-6H2;1-4,7-8,22H,5-6,21H2 |
| InChIKey | FZVVNCASTQILPE-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.49 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|