About 2-(tributyl-λ5-phosphanylidene)acetonitrile
2-(tributyl-λ5-phosphanylidene)acetonitrile (PubChem CID 158192317) has the molecular formula C28H56N2P2
and a molecular weight of 482.72 g/mol. Its IUPAC name is 2-(tributyl-λ5-phosphanylidene)acetonitrile.
Molecular Properties
| Compound Name | 2-(tributyl-λ5-phosphanylidene)acetonitrile |
| PubChem CID | 158192317 |
| Molecular Formula | C28H56N2P2 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | 2-(tributyl-λ5-phosphanylidene)acetonitrile |
| SMILES | CCCCP(=CC#N)(CCCC)CCCC.CCCCP(=CC#N)(CCCC)CCCC |
| InChI | InChI=1S/2C14H28NP/c2*1-4-7-11-16(14-10-15,12-8-5-2)13-9-6-3/h2*14H,4-9,11-13H2,1-3H3 |
| InChIKey | FZXJEALDDVEPSV-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(tributyl-λ5-phosphanylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tributyl-λ5-phosphanylidene)acetonitrile?
The IUPAC name of 2-(tributyl-λ5-phosphanylidene)acetonitrile (CID 158192317) is 2-(tributyl-λ5-phosphanylidene)acetonitrile.
What is the SMILES notation for 2-(tributyl-λ5-phosphanylidene)acetonitrile?
The canonical SMILES for 2-(tributyl-λ5-phosphanylidene)acetonitrile is CCCCP(=CC#N)(CCCC)CCCC.CCCCP(=CC#N)(CCCC)CCCC.
What is the InChIKey of 2-(tributyl-λ5-phosphanylidene)acetonitrile?
The InChIKey is FZXJEALDDVEPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H28NP/c2*1-4-7-11-16(14-10-15,12-8-5-2)13-9-6-3/h2*14H,4-9,11-13H2,1-3H3.
What are the key properties of 2-(tributyl-λ5-phosphanylidene)acetonitrile?
2-(tributyl-λ5-phosphanylidene)acetonitrile has a molecular weight of 482.72 g/mol, XLogP of 9.46, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tributyl-λ5-phosphanylidene)acetonitrile is sourced from PubChem (CID 158192317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).