C22H24N2O3S — CID 158193362
4-methylbenzenesulfonic acid;N'-(4-methylphenyl)-2-phenylethanimidamide (PubChem CID 158193362) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;N'-(4-methylphenyl)-2-phenylethanimidamide.
| Compound Name | 4-methylbenzenesulfonic acid;N'-(4-methylphenyl)-2-phenylethanimidamide |
|---|---|
| PubChem CID | 158193362 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-methylbenzenesulfonic acid;N'-(4-methylphenyl)-2-phenylethanimidamide |
| SMILES | Cc1ccc(/N=C(\N)Cc2ccccc2)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H16N2.C7H8O3S/c1-12-7-9-14(10-8-12)17-15(16)11-13-5-3-2-4-6-13;1-6-2-4-7(5-3-6)11(8,9)10/h2-10H,11H2,1H3,(H2,16,17);2-5H,1H3,(H,8,9,10) |
| InChIKey | GAAPGBDKOKBBLB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|