C44H65N7O11 — CID 158193761
6-amino-2-[[4-oxo-6-phenyl-5-[[4-[[1,4,7-tris(carboxymethyl)-10-(2-methylpropyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]benzoyl]amino]hexanoyl]amino]hexanoic acid (PubChem CID 158193761) has the molecular formula C44H65N7O11 and a molecular weight of 868.04 g/mol. Its IUPAC name is 6-amino-2-[[4-oxo-6-phenyl-5-[[4-[[1,4,7-tris(carboxymethyl)-10-(2-methylpropyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]benzoyl]amino]hexanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[4-oxo-6-phenyl-5-[[4-[[1,4,7-tris(carboxymethyl)-10-(2-methylpropyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]benzoyl]amino]hexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 158193761 |
| Molecular Formula | C44H65N7O11 |
| Molecular Weight | 868.04 g/mol |
| Exact Mass | 867.47 |
| IUPAC Name | 6-amino-2-[[4-oxo-6-phenyl-5-[[4-[[1,4,7-tris(carboxymethyl)-10-(2-methylpropyl)-1,4,7,10-tetrazacyclododec-2-yl]methyl]benzoyl]amino]hexanoyl]amino]hexanoic acid |
| SMILES | CC(C)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC(Cc2ccc(C(=O)NC(Cc3ccccc3)C(=O)CCC(=O)NC(CCCCN)C(=O)O)cc2)N(CC(=O)O)CC1 |
| InChI | InChI=1S/C44H65N7O11/c1-31(2)26-48-18-19-49(28-40(54)55)20-21-50(29-41(56)57)27-35(51(23-22-48)30-42(58)59)24-33-11-13-34(14-12-33)43(60)47-37(25-32-8-4-3-5-9-32)38(52)15-16-39(53)46-36(44(61)62)10-6-7-17-45/h3-5,8-9,11-14,31,35-37H,6-7,10,15-30,45H2,1-2H3,(H,46,53)(H,47,60)(H,54,55)(H,56,57)(H,58,59)(H,61,62) |
| InChIKey | KYZRZXZTIXWQRV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 263.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.04 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|