About dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline
dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline (PubChem CID 158194870) has the molecular formula C17H28Cl2NNiP
and a molecular weight of 406.99 g/mol. Its IUPAC name is dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline |
| PubChem CID | 158194870 |
| Molecular Formula | C17H28Cl2NNiP |
| Molecular Weight | 406.99 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline |
| SMILES | CC(C)P(C=CCc1ccc(N(C)C)cc1)C(C)C.Cl[Ni]Cl |
| InChI | InChI=1S/C17H28NP.2ClH.Ni/c1-14(2)19(15(3)4)13-7-8-16-9-11-17(12-10-16)18(5)6;;;/h7,9-15H,8H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | GAFJFNJOTNNXBX-UHFFFAOYSA-L |
| XLogP | 6.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.99 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline?
The IUPAC name of dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline (CID 158194870) is dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline.
What is the SMILES notation for dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline?
The canonical SMILES for dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline is CC(C)P(C=CCc1ccc(N(C)C)cc1)C(C)C.Cl[Ni]Cl.
What is the InChIKey of dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline?
The InChIKey is GAFJFNJOTNNXBX-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H28NP.2ClH.Ni/c1-14(2)19(15(3)4)13-7-8-16-9-11-17(12-10-16)18(5)6;;;/h7,9-15H,8H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline?
dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline has a molecular weight of 406.99 g/mol, XLogP of 6.48, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;4-[3-di(propan-2-yl)phosphanylprop-2-enyl]-N,N-dimethylaniline is sourced from PubChem (CID 158194870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).