C23H25F9N2O11S — CID 158195170
methyl 5-hydroxy-6-methylpyridine-2-carboxylate;methyl 6-methyl-5-[2-(trifluoromethoxy)ethoxy]pyridine-2-carboxylate;2-(trifluoromethoxy)ethyl trifluoromethanesulfonate (PubChem CID 158195170) has the molecular formula C23H25F9N2O11S and a molecular weight of 708.50 g/mol. Its IUPAC name is methyl 5-hydroxy-6-methylpyridine-2-carboxylate;methyl 6-methyl-5-[2-(trifluoromethoxy)ethoxy]pyridine-2-carboxylate;2-(trifluoromethoxy)ethyl trifluoromethanesulfonate.
| Compound Name | methyl 5-hydroxy-6-methylpyridine-2-carboxylate;methyl 6-methyl-5-[2-(trifluoromethoxy)ethoxy]pyridine-2-carboxylate;2-(trifluoromethoxy)ethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158195170 |
| Molecular Formula | C23H25F9N2O11S |
| Molecular Weight | 708.50 g/mol |
| Exact Mass | 708.10 |
| IUPAC Name | methyl 5-hydroxy-6-methylpyridine-2-carboxylate;methyl 6-methyl-5-[2-(trifluoromethoxy)ethoxy]pyridine-2-carboxylate;2-(trifluoromethoxy)ethyl trifluoromethanesulfonate |
| SMILES | COC(=O)c1ccc(O)c(C)n1.COC(=O)c1ccc(OCCOC(F)(F)F)c(C)n1.O=S(=O)(OCCOC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO4.C8H9NO3.C4H4F6O4S/c1-7-9(18-5-6-19-11(12,13)14)4-3-8(15-7)10(16)17-2;1-5-7(10)4-3-6(9-5)8(11)12-2;5-3(6,7)13-1-2-14-15(11,12)4(8,9)10/h3-4H,5-6H2,1-2H3;3-4,10H,1-2H3;1-2H2 |
| InChIKey | GAGDOQZJJRZMGW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 169.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|