About 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride
2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride (PubChem CID 158197858) has the molecular formula C11H20ClN3O5
and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride.
Molecular Properties
| Compound Name | 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride |
| PubChem CID | 158197858 |
| Molecular Formula | C11H20ClN3O5 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride |
| SMILES | CN(CC(=O)OC(C)(C)[C@@H]1CNC(=O)O1)C(=O)CN.Cl |
| InChI | InChI=1S/C11H19N3O5.ClH/c1-11(2,7-5-13-10(17)18-7)19-9(16)6-14(3)8(15)4-12;/h7H,4-6,12H2,1-3H3,(H,13,17);1H/t7-;/m0./s1 |
| InChIKey | OUBCHPXYMYRXLQ-FJXQXJEOSA-N |
| XLogP | -0.74 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride?
The IUPAC name of 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride (CID 158197858) is 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride.
What is the SMILES notation for 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride?
The canonical SMILES for 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride is CN(CC(=O)OC(C)(C)[C@@H]1CNC(=O)O1)C(=O)CN.Cl.
What is the InChIKey of 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride?
The InChIKey is OUBCHPXYMYRXLQ-FJXQXJEOSA-N. The full InChI is InChI=1S/C11H19N3O5.ClH/c1-11(2,7-5-13-10(17)18-7)19-9(16)6-14(3)8(15)4-12;/h7H,4-6,12H2,1-3H3,(H,13,17);1H/t7-;/m0./s1.
What are the key properties of 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride?
2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride has a molecular weight of 309.75 g/mol, XLogP of -0.74, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S)-2-oxo-1,3-oxazolidin-5-yl]propan-2-yl 2-[(2-aminoacetyl)-methylamino]acetate;hydrochloride is sourced from PubChem (CID 158197858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).