About (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+)
(2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) (PubChem CID 158197892) has the molecular formula C11H21NOU
and a molecular weight of 421.32 g/mol. Its IUPAC name is (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+).
Molecular Properties
| Compound Name | (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) |
| PubChem CID | 158197892 |
| Molecular Formula | C11H21NOU |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) |
| SMILES | C/C=C(/C)OC[C@@H]1C[CH-]CN1C.[CH3-].[U+2] |
| InChI | InChI=1S/C10H18NO.CH3.U/c1-4-9(2)12-8-10-6-5-7-11(10)3;;/h4-5,10H,6-8H2,1-3H3;1H3;/q2*-1;+2/b9-4-;;/t10-;;/m0../s1 |
| InChIKey | KBNUPSLIOUSNHJ-ZPEDOYBFSA-N |
| XLogP | 2.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+)?
The IUPAC name of (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) (CID 158197892) is (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+).
What is the SMILES notation for (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+)?
The canonical SMILES for (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) is C/C=C(/C)OC[C@@H]1C[CH-]CN1C.[CH3-].[U+2].
What is the InChIKey of (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+)?
The InChIKey is KBNUPSLIOUSNHJ-ZPEDOYBFSA-N. The full InChI is InChI=1S/C10H18NO.CH3.U/c1-4-9(2)12-8-10-6-5-7-11(10)3;;/h4-5,10H,6-8H2,1-3H3;1H3;/q2*-1;+2/b9-4-;;/t10-;;/m0../s1.
What are the key properties of (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+)?
(2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) has a molecular weight of 421.32 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(Z)-but-2-en-2-yl]oxymethyl]-1-methylpyrrolidin-4-ide;carbanide;uranium(2+) is sourced from PubChem (CID 158197892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).