C33H36F4O7S2 — CID 158198176
2-[2,4-bis(propan-2-yloxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium (PubChem CID 158198176) has the molecular formula C33H36F4O7S2 and a molecular weight of 684.77 g/mol. Its IUPAC name is 2-[2,4-bis(propan-2-yloxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium.
| Compound Name | 2-[2,4-bis(propan-2-yloxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 158198176 |
| Molecular Formula | C33H36F4O7S2 |
| Molecular Weight | 684.77 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 2-[2,4-bis(propan-2-yloxycarbonyl)cyclopentyl]-1,1,2,2-tetrafluoroethanesulfonate;triphenylsulfanium |
| SMILES | CC(C)OC(=O)C1CC(C(=O)OC(C)C)C(C(F)(F)C(F)(F)S(=O)(=O)[O-])C1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C15H22F4O7S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7(2)25-12(20)9-5-10(13(21)26-8(3)4)11(6-9)14(16,17)15(18,19)27(22,23)24/h1-15H;7-11H,5-6H2,1-4H3,(H,22,23,24)/q+1;/p-1 |
| InChIKey | GAPFVOVIAVBWKK-UHFFFAOYSA-M |
| XLogP | 7.09 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.77 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|