C24H30N10O — CID 158198632
ethane;4-N-methyl-2-N-[[[4-(methylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]methoxymethyl]-6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 158198632) has the molecular formula C24H30N10O and a molecular weight of 474.57 g/mol. Its IUPAC name is ethane;4-N-methyl-2-N-[[[4-(methylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]methoxymethyl]-6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | ethane;4-N-methyl-2-N-[[[4-(methylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]methoxymethyl]-6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 158198632 |
| Molecular Formula | C24H30N10O |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | ethane;4-N-methyl-2-N-[[[4-(methylamino)-6-phenyl-1,3,5-triazin-2-yl]amino]methoxymethyl]-6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC.CNc1nc(NCOCNc2nc(NC)nc(-c3ccccc3)n2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H24N10O.C2H6/c1-23-19-27-17(15-9-5-3-6-10-15)29-21(31-19)25-13-33-14-26-22-30-18(28-20(24-2)32-22)16-11-7-4-8-12-16;1-2/h3-12H,13-14H2,1-2H3,(H2,23,25,27,29,31)(H2,24,26,28,30,32);1-2H3 |
| InChIKey | GAQPOWUNQGNFGJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|