C29H31N3O — CID 158199358
1-[4-[(3aR,4R,9bR)-4-ethyl-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]phenyl]but-3-en-2-one (PubChem CID 158199358) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is 1-[4-[(3aR,4R,9bR)-4-ethyl-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[4-[(3aR,4R,9bR)-4-ethyl-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158199358 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[4-[(3aR,4R,9bR)-4-ethyl-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccc(-c2ccc3c(c2)[C@H]2[C@H](CCN2Cc2ccncc2)[C@@H](CC)N3)cc1 |
| InChI | InChI=1S/C29H31N3O/c1-3-24(33)17-20-5-7-22(8-6-20)23-9-10-28-26(18-23)29-25(27(4-2)31-28)13-16-32(29)19-21-11-14-30-15-12-21/h3,5-12,14-15,18,25,27,29,31H,1,4,13,16-17,19H2,2H3/t25-,27-,29-/m1/s1 |
| InChIKey | ZDRJVCGAFSXPCV-ONDZYYNLSA-N |
| XLogP | 5.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|