About CID 158199458
CID 158199458 (PubChem CID 158199458) has the molecular formula C37H37BCl5N8OS3
and a molecular weight of 894.04 g/mol.
Molecular Properties
| Compound Name | CID 158199458 |
| PubChem CID | 158199458 |
| Molecular Formula | C37H37BCl5N8OS3 |
| Molecular Weight | 894.04 g/mol |
| Exact Mass | 891.08 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H]1CCCC12CCN(c1ncc(Sc3cccc(Cl)c3Cl)c3nccn13)CC2.Clc1cccc(Sc2cnc(Cl)n3ccnc23)c1Cl.[B] |
| InChI | InChI=1S/C25H31Cl2N5OS2.C12H6Cl3N3S.B/c1-24(2,3)35(33)30-20-8-5-9-25(20)10-13-31(14-11-25)23-29-16-19(22-28-12-15-32(22)23)34-18-7-4-6-17(26)21(18)27;13-7-2-1-3-8(10(7)14)19-9-6-17-12(15)18-5-4-16-11(9)18;/h4,6-7,12,15-16,20,30H,5,8-11,13-14H2,1-3H3;1-6H;/t20-,35-;;/m1../s1 |
| InChIKey | VVXKLBATSDTQKM-VLWSLGHDSA-N |
| XLogP | 10.84 |
| TPSA | 92.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 894.04 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158199458 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158199458?
The IUPAC name of CID 158199458 (CID 158199458) is not available.
What is the SMILES notation for CID 158199458?
The canonical SMILES for CID 158199458 is CC(C)(C)[S@@](=O)N[C@@H]1CCCC12CCN(c1ncc(Sc3cccc(Cl)c3Cl)c3nccn13)CC2.Clc1cccc(Sc2cnc(Cl)n3ccnc23)c1Cl.[B].
What is the InChIKey of CID 158199458?
The InChIKey is VVXKLBATSDTQKM-VLWSLGHDSA-N. The full InChI is InChI=1S/C25H31Cl2N5OS2.C12H6Cl3N3S.B/c1-24(2,3)35(33)30-20-8-5-9-25(20)10-13-31(14-11-25)23-29-16-19(22-28-12-15-32(22)23)34-18-7-4-6-17(26)21(18)27;13-7-2-1-3-8(10(7)14)19-9-6-17-12(15)18-5-4-16-11(9)18;/h4,6-7,12,15-16,20,30H,5,8-11,13-14H2,1-3H3;1-6H;/t20-,35-;;/m1../s1.
What are the key properties of CID 158199458?
CID 158199458 has a molecular weight of 894.04 g/mol, XLogP of 10.84, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158199458 is sourced from PubChem (CID 158199458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).