About 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium
2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium (PubChem CID 158199845) has the molecular formula C30H29F2O3S+
and a molecular weight of 507.62 g/mol. Its IUPAC name is 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium |
| PubChem CID | 158199845 |
| Molecular Formula | C30H29F2O3S+ |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OCCOC1C=CC=CC1(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H14F2O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)11(15)17-8-7-16-10-5-3-4-6-12(10,13)14/h1-15H;3-6,10H,1,7-8H2,2H3/q+1; |
| InChIKey | GAUHMQPSMWQGJA-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium?
The IUPAC name of 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium (CID 158199845) is 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium.
What is the SMILES notation for 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium?
The canonical SMILES for 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium is C=C(C)C(=O)OCCOC1C=CC=CC1(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium?
The InChIKey is GAUHMQPSMWQGJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C12H14F2O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(2)11(15)17-8-7-16-10-5-3-4-6-12(10,13)14/h1-15H;3-6,10H,1,7-8H2,2H3/q+1;.
What are the key properties of 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium?
2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium has a molecular weight of 507.62 g/mol, XLogP of 7.03, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-difluorocyclohexa-2,4-dien-1-yl)oxyethyl 2-methylprop-2-enoate;triphenylsulfanium is sourced from PubChem (CID 158199845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).