About 3,3-dinitropropan-1-amine
3,3-dinitropropan-1-amine (PubChem CID 15820033) has the molecular formula C3H7N3O4
and a molecular weight of 149.11 g/mol. Its IUPAC name is 3,3-dinitropropan-1-amine.
Molecular Properties
| Compound Name | 3,3-dinitropropan-1-amine |
| PubChem CID | 15820033 |
| Molecular Formula | C3H7N3O4 |
| Molecular Weight | 149.11 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | 3,3-dinitropropan-1-amine |
| SMILES | NCCC([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3H7N3O4/c4-2-1-3(5(7)8)6(9)10/h3H,1-2,4H2 |
| InChIKey | AYCMSQSZGUOVAR-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.11 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dinitropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dinitropropan-1-amine?
The IUPAC name of 3,3-dinitropropan-1-amine (CID 15820033) is 3,3-dinitropropan-1-amine.
What is the SMILES notation for 3,3-dinitropropan-1-amine?
The canonical SMILES for 3,3-dinitropropan-1-amine is NCCC([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 3,3-dinitropropan-1-amine?
The InChIKey is AYCMSQSZGUOVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O4/c4-2-1-3(5(7)8)6(9)10/h3H,1-2,4H2.
What are the key properties of 3,3-dinitropropan-1-amine?
3,3-dinitropropan-1-amine has a molecular weight of 149.11 g/mol, XLogP of -0.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dinitropropan-1-amine is sourced from PubChem (CID 15820033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).