C21H15Cl2NO5S — CID 158200674
2-(2,4-dichlorophenyl)-1-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethanone (PubChem CID 158200674) has the molecular formula C21H15Cl2NO5S and a molecular weight of 464.33 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethanone |
|---|---|
| PubChem CID | 158200674 |
| Molecular Formula | C21H15Cl2NO5S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-[2-[(4-nitrophenyl)sulfonylmethyl]phenyl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)c1ccccc1CS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15Cl2NO5S/c22-16-6-5-14(20(23)12-16)11-21(25)19-4-2-1-3-15(19)13-30(28,29)18-9-7-17(8-10-18)24(26)27/h1-10,12H,11,13H2 |
| InChIKey | NKMJEHOBFMDRTA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|