C28H27F9N6O4 — CID 158201036
1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-methyl-6-[4-[3-(2-morpholin-4-ylethylamino)propoxy]-3-(trifluoromethyl)phenyl]imidazo[4,5-c]pyridine-4-carbonitrile (PubChem CID 158201036) has the molecular formula C28H27F9N6O4 and a molecular weight of 682.54 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-methyl-6-[4-[3-(2-morpholin-4-ylethylamino)propoxy]-3-(trifluoromethyl)phenyl]imidazo[4,5-c]pyridine-4-carbonitrile.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-methyl-6-[4-[3-(2-morpholin-4-ylethylamino)propoxy]-3-(trifluoromethyl)phenyl]imidazo[4,5-c]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 158201036 |
| Molecular Formula | C28H27F9N6O4 |
| Molecular Weight | 682.54 g/mol |
| Exact Mass | 682.20 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;1-methyl-6-[4-[3-(2-morpholin-4-ylethylamino)propoxy]-3-(trifluoromethyl)phenyl]imidazo[4,5-c]pyridine-4-carbonitrile |
| SMILES | Cn1cnc2c(C#N)nc(-c3ccc(OCCCNCCN4CCOCC4)c(C(F)(F)F)c3)cc21.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H27F3N6O2.C4F6O2/c1-32-16-30-23-20(15-28)31-19(14-21(23)32)17-3-4-22(18(13-17)24(25,26)27)35-10-2-5-29-6-7-33-8-11-34-12-9-33;5-3(6,7)1(11)2(12)4(8,9)10/h3-4,13-14,16,29H,2,5-12H2,1H3; |
| InChIKey | GAXYNMYGPUHNTL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|