C20H20F2N2O3 — CID 158201534
(4aR,8aS)-6-[3-[2-(2,6-difluorophenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 158201534) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[2-(2,6-difluorophenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[2-(2,6-difluorophenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 158201534 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (4aR,8aS)-6-[3-[2-(2,6-difluorophenyl)ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(C#Cc4c(F)cccc4F)C3)C[C@H]2C1 |
| InChI | InChI=1S/C20H20F2N2O3/c21-17-2-1-3-18(22)16(17)5-4-13-9-24(10-13)20(26)23-7-6-19-14(11-23)8-15(25)12-27-19/h1-3,13-14,19H,6-12H2/t14-,19+/m1/s1 |
| InChIKey | GAZOAZDJXRNWAT-KUHUBIRLSA-N |
| XLogP | 2.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|