About 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid
4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid (PubChem CID 158202990) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid.
Molecular Properties
| Compound Name | 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid |
| PubChem CID | 158202990 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid |
| SMILES | CC(=O)CCn1cccc1.O=C(O)CCn1cccc1 |
| InChI | InChI=1S/C8H11NO.C7H9NO2/c1-8(10)4-7-9-5-2-3-6-9;9-7(10)3-6-8-4-1-2-5-8/h2-3,5-6H,4,7H2,1H3;1-2,4-5H,3,6H2,(H,9,10) |
| InChIKey | GBDVNSNZYNWTKG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid?
The IUPAC name of 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid (CID 158202990) is 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid.
What is the SMILES notation for 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid?
The canonical SMILES for 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid is CC(=O)CCn1cccc1.O=C(O)CCn1cccc1.
What is the InChIKey of 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid?
The InChIKey is GBDVNSNZYNWTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C7H9NO2/c1-8(10)4-7-9-5-2-3-6-9;9-7(10)3-6-8-4-1-2-5-8/h2-3,5-6H,4,7H2,1H3;1-2,4-5H,3,6H2,(H,9,10).
What are the key properties of 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid?
4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid has a molecular weight of 276.34 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrol-1-ylbutan-2-one;3-pyrrol-1-ylpropanoic acid is sourced from PubChem (CID 158202990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).