C46H42ClN7O8 — CID 158204653
ethyl 4-chloro-6-phenylpyrimidine-5-carboxylate;ethyl 6-oxo-4-phenyl-1H-pyrimidine-5-carboxylate;ethyl 4-phenyl-6-(phenylmethoxyamino)pyrimidine-5-carboxylate (PubChem CID 158204653) has the molecular formula C46H42ClN7O8 and a molecular weight of 856.34 g/mol. Its IUPAC name is ethyl 4-chloro-6-phenylpyrimidine-5-carboxylate;ethyl 6-oxo-4-phenyl-1H-pyrimidine-5-carboxylate;ethyl 4-phenyl-6-(phenylmethoxyamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-chloro-6-phenylpyrimidine-5-carboxylate;ethyl 6-oxo-4-phenyl-1H-pyrimidine-5-carboxylate;ethyl 4-phenyl-6-(phenylmethoxyamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 158204653 |
| Molecular Formula | C46H42ClN7O8 |
| Molecular Weight | 856.34 g/mol |
| Exact Mass | 855.28 |
| IUPAC Name | ethyl 4-chloro-6-phenylpyrimidine-5-carboxylate;ethyl 6-oxo-4-phenyl-1H-pyrimidine-5-carboxylate;ethyl 4-phenyl-6-(phenylmethoxyamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc[nH]c1=O.CCOC(=O)c1c(Cl)ncnc1-c1ccccc1.CCOC(=O)c1c(NOCc2ccccc2)ncnc1-c1ccccc1 |
| InChI | InChI=1S/C20H19N3O3.C13H11ClN2O2.C13H12N2O3/c1-2-25-20(24)17-18(16-11-7-4-8-12-16)21-14-22-19(17)23-26-13-15-9-5-3-6-10-15;1-2-18-13(17)10-11(15-8-16-12(10)14)9-6-4-3-5-7-9;1-2-18-13(17)10-11(14-8-15-12(10)16)9-6-4-3-5-7-9/h3-12,14H,2,13H2,1H3,(H,21,22,23);3-8H,2H2,1H3;3-8H,2H2,1H3,(H,14,15,16) |
| InChIKey | GBISASIZGKFARJ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 197.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.34 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|