C12H9BrF2N2O2S — CID 158204803
5-bromo-3-[(2,4-difluorophenyl)methylsulfonyl]pyridin-2-amine (PubChem CID 158204803) has the molecular formula C12H9BrF2N2O2S and a molecular weight of 363.18 g/mol. Its IUPAC name is 5-bromo-3-[(2,4-difluorophenyl)methylsulfonyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-[(2,4-difluorophenyl)methylsulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 158204803 |
| Molecular Formula | C12H9BrF2N2O2S |
| Molecular Weight | 363.18 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 5-bromo-3-[(2,4-difluorophenyl)methylsulfonyl]pyridin-2-amine |
| SMILES | Nc1ncc(Br)cc1S(=O)(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C12H9BrF2N2O2S/c13-8-3-11(12(16)17-5-8)20(18,19)6-7-1-2-9(14)4-10(7)15/h1-5H,6H2,(H2,16,17) |
| InChIKey | QAHBXDKLTDVUGD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |