C24H30N2O3S2 — CID 158205954
2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]thiophen-2-yl]phenyl]methyl]-N-methyloctanamide (PubChem CID 158205954) has the molecular formula C24H30N2O3S2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]thiophen-2-yl]phenyl]methyl]-N-methyloctanamide.
| Compound Name | 2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]thiophen-2-yl]phenyl]methyl]-N-methyloctanamide |
|---|---|
| PubChem CID | 158205954 |
| Molecular Formula | C24H30N2O3S2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[[3-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]thiophen-2-yl]phenyl]methyl]-N-methyloctanamide |
| SMILES | CCCCCCC(Cc1cccc(-c2ccc(CC3SC(=O)NC3=O)s2)c1)C(=O)NC |
| InChI | InChI=1S/C24H30N2O3S2/c1-3-4-5-6-9-18(22(27)25-2)14-16-8-7-10-17(13-16)20-12-11-19(30-20)15-21-23(28)26-24(29)31-21/h7-8,10-13,18,21H,3-6,9,14-15H2,1-2H3,(H,25,27)(H,26,28,29) |
| InChIKey | QFVZZSMQEFZUTE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|