C30H45FN2O4 — CID 158206098
(2R)-2-(decylamino)-2-(6-propoxy-3-pyridinyl)ethanol;trans-(1S,2S)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 158206098) has the molecular formula C30H45FN2O4 and a molecular weight of 516.70 g/mol. Its IUPAC name is (2R)-2-(decylamino)-2-(6-propoxy-3-pyridinyl)ethanol;trans-(1S,2S)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid.
| Compound Name | (2R)-2-(decylamino)-2-(6-propoxy-3-pyridinyl)ethanol;trans-(1S,2S)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 158206098 |
| Molecular Formula | C30H45FN2O4 |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | (2R)-2-(decylamino)-2-(6-propoxy-3-pyridinyl)ethanol;trans-(1S,2S)-2-(3-fluorophenyl)cyclopropane-1-carboxylic acid |
| SMILES | CCCCCCCCCCN[C@@H](CO)c1ccc(OCCC)nc1.O=C(O)[C@H]1C[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C20H36N2O2.C10H9FO2/c1-3-5-6-7-8-9-10-11-14-21-19(17-23)18-12-13-20(22-16-18)24-15-4-2;11-7-3-1-2-6(4-7)8-5-9(8)10(12)13/h12-13,16,19,21,23H,3-11,14-15,17H2,1-2H3;1-4,8-9H,5H2,(H,12,13)/t19-;8-,9+/m01/s1 |
| InChIKey | GBMZGIIOYOXZMR-QESJTUFZSA-N |
| XLogP | 6.65 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|