C28H26N8O — CID 158206754
6-N-cyclohexyl-4-N-[3-ethynyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 158206754) has the molecular formula C28H26N8O and a molecular weight of 490.57 g/mol. Its IUPAC name is 6-N-cyclohexyl-4-N-[3-ethynyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 6-N-cyclohexyl-4-N-[3-ethynyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 158206754 |
| Molecular Formula | C28H26N8O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 6-N-cyclohexyl-4-N-[3-ethynyl-4-(1-methylbenzimidazol-5-yl)oxyphenyl]pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | C#Cc1cc(Nc2ncnc3cnc(NC4CCCCC4)nc23)ccc1Oc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C28H26N8O/c1-3-18-13-20(9-12-25(18)37-21-10-11-24-22(14-21)32-17-36(24)2)33-27-26-23(30-16-31-27)15-29-28(35-26)34-19-7-5-4-6-8-19/h1,9-17,19H,4-8H2,2H3,(H,29,34,35)(H,30,31,33) |
| InChIKey | GBOXWIBKAOTGLP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|